C24H23N3O4 — CID 11316039
methyl (2S)-3-(6-amino-2-pyridinyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate (PubChem CID 11316039) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is methyl (2S)-3-(6-amino-2-pyridinyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate.
| Compound Name | methyl (2S)-3-(6-amino-2-pyridinyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 11316039 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | methyl (2S)-3-(6-amino-2-pyridinyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
| SMILES | COC(=O)[C@H](Cc1cccc(N)n1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H23N3O4/c1-30-23(28)21(13-15-7-6-12-22(25)26-15)27-24(29)31-14-20-18-10-4-2-8-16(18)17-9-3-5-11-19(17)20/h2-12,20-21H,13-14H2,1H3,(H2,25,26)(H,27,29)/t21-/m0/s1 |
| InChIKey | XFAXSNYIYWACEY-NRFANRHFSA-N |
| XLogP | 3.29 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |