C20H21ClN2O4 — CID 113162670
ethyl 2-[[2-[acetyl-[(2-chlorophenyl)methyl]amino]acetyl]amino]benzoate (PubChem CID 113162670) has the molecular formula C20H21ClN2O4 and a molecular weight of 388.85 g/mol. Its IUPAC name is ethyl 2-[[2-[acetyl-[(2-chlorophenyl)methyl]amino]acetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-[acetyl-[(2-chlorophenyl)methyl]amino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 113162670 |
| Molecular Formula | C20H21ClN2O4 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | ethyl 2-[[2-[acetyl-[(2-chlorophenyl)methyl]amino]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)CN(Cc1ccccc1Cl)C(C)=O |
| InChI | InChI=1S/C20H21ClN2O4/c1-3-27-20(26)16-9-5-7-11-18(16)22-19(25)13-23(14(2)24)12-15-8-4-6-10-17(15)21/h4-11H,3,12-13H2,1-2H3,(H,22,25) |
| InChIKey | JPTLWTWOQYLRAA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |