C22H27N3O4S — CID 11316346
(4S,5R)-4-[(1R)-1-azido-2-phenylmethoxyethyl]-2,2-dimethyl-5-[[(S)-(4-methylphenyl)sulfinyl]methyl]-1,3-dioxolane (PubChem CID 11316346) has the molecular formula C22H27N3O4S and a molecular weight of 429.54 g/mol. Its IUPAC name is (4S,5R)-4-[(1R)-1-azido-2-phenylmethoxyethyl]-2,2-dimethyl-5-[[(S)-(4-methylphenyl)sulfinyl]methyl]-1,3-dioxolane.
| Compound Name | (4S,5R)-4-[(1R)-1-azido-2-phenylmethoxyethyl]-2,2-dimethyl-5-[[(S)-(4-methylphenyl)sulfinyl]methyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 11316346 |
| Molecular Formula | C22H27N3O4S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | (4S,5R)-4-[(1R)-1-azido-2-phenylmethoxyethyl]-2,2-dimethyl-5-[[(S)-(4-methylphenyl)sulfinyl]methyl]-1,3-dioxolane |
| SMILES | Cc1ccc([S@@](=O)C[C@@H]2OC(C)(C)O[C@H]2[C@@H](COCc2ccccc2)N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C22H27N3O4S/c1-16-9-11-18(12-10-16)30(26)15-20-21(29-22(2,3)28-20)19(24-25-23)14-27-13-17-7-5-4-6-8-17/h4-12,19-21H,13-15H2,1-3H3/t19-,20+,21+,30+/m1/s1 |
| InChIKey | IGYLYQRZZLVQLY-LIASHVPGSA-N |
| XLogP | 4.52 |
| TPSA | 93.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|