C22H29N3O2 — CID 113168581
2-(N-acetyl-3,5-dimethylanilino)-N-[4-(diethylamino)phenyl]acetamide (PubChem CID 113168581) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is 2-(N-acetyl-3,5-dimethylanilino)-N-[4-(diethylamino)phenyl]acetamide.
| Compound Name | 2-(N-acetyl-3,5-dimethylanilino)-N-[4-(diethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 113168581 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 2-(N-acetyl-3,5-dimethylanilino)-N-[4-(diethylamino)phenyl]acetamide |
| SMILES | CCN(CC)c1ccc(NC(=O)CN(C(C)=O)c2cc(C)cc(C)c2)cc1 |
| InChI | InChI=1S/C22H29N3O2/c1-6-24(7-2)20-10-8-19(9-11-20)23-22(27)15-25(18(5)26)21-13-16(3)12-17(4)14-21/h8-14H,6-7,15H2,1-5H3,(H,23,27) |
| InChIKey | KWKIQGLQUZQKSZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|