C22H27N3O2 — CID 113168582
2-(N-acetyl-3,5-dimethylanilino)-N-(4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 113168582) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 2-(N-acetyl-3,5-dimethylanilino)-N-(4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-(N-acetyl-3,5-dimethylanilino)-N-(4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 113168582 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 2-(N-acetyl-3,5-dimethylanilino)-N-(4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | CC(=O)N(CC(=O)Nc1ccc(N2CCCC2)cc1)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C22H27N3O2/c1-16-12-17(2)14-21(13-16)25(18(3)26)15-22(27)23-19-6-8-20(9-7-19)24-10-4-5-11-24/h6-9,12-14H,4-5,10-11,15H2,1-3H3,(H,23,27) |
| InChIKey | MQNVPHAHTFVYPM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|