C21H25ClN2O3 — CID 113172865
2-(N-acetyl-5-chloro-2-methoxyanilino)-N-(2,6-diethylphenyl)acetamide (PubChem CID 113172865) has the molecular formula C21H25ClN2O3 and a molecular weight of 388.90 g/mol. Its IUPAC name is 2-(N-acetyl-5-chloro-2-methoxyanilino)-N-(2,6-diethylphenyl)acetamide.
| Compound Name | 2-(N-acetyl-5-chloro-2-methoxyanilino)-N-(2,6-diethylphenyl)acetamide |
|---|---|
| PubChem CID | 113172865 |
| Molecular Formula | C21H25ClN2O3 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 2-(N-acetyl-5-chloro-2-methoxyanilino)-N-(2,6-diethylphenyl)acetamide |
| SMILES | CCc1cccc(CC)c1NC(=O)CN(C(C)=O)c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C21H25ClN2O3/c1-5-15-8-7-9-16(6-2)21(15)23-20(26)13-24(14(3)25)18-12-17(22)10-11-19(18)27-4/h7-12H,5-6,13H2,1-4H3,(H,23,26) |
| InChIKey | VIFURSDYYVEJNB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |