C18H18Cl2N2O3 — CID 113174178
2-(N-acetyl-2-methoxy-5-methylanilino)-N-(2,6-dichlorophenyl)acetamide (PubChem CID 113174178) has the molecular formula C18H18Cl2N2O3 and a molecular weight of 381.26 g/mol. Its IUPAC name is 2-(N-acetyl-2-methoxy-5-methylanilino)-N-(2,6-dichlorophenyl)acetamide.
| Compound Name | 2-(N-acetyl-2-methoxy-5-methylanilino)-N-(2,6-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 113174178 |
| Molecular Formula | C18H18Cl2N2O3 |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 2-(N-acetyl-2-methoxy-5-methylanilino)-N-(2,6-dichlorophenyl)acetamide |
| SMILES | COc1ccc(C)cc1N(CC(=O)Nc1c(Cl)cccc1Cl)C(C)=O |
| InChI | InChI=1S/C18H18Cl2N2O3/c1-11-7-8-16(25-3)15(9-11)22(12(2)23)10-17(24)21-18-13(19)5-4-6-14(18)20/h4-9H,10H2,1-3H3,(H,21,24) |
| InChIKey | IVIKIIWORJDWJJ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |