C19H21ClN2O4 — CID 113174537
2-(N-acetyl-2,5-dimethoxyanilino)-N-[(4-chlorophenyl)methyl]acetamide (PubChem CID 113174537) has the molecular formula C19H21ClN2O4 and a molecular weight of 376.84 g/mol. Its IUPAC name is 2-(N-acetyl-2,5-dimethoxyanilino)-N-[(4-chlorophenyl)methyl]acetamide.
| Compound Name | 2-(N-acetyl-2,5-dimethoxyanilino)-N-[(4-chlorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 113174537 |
| Molecular Formula | C19H21ClN2O4 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 2-(N-acetyl-2,5-dimethoxyanilino)-N-[(4-chlorophenyl)methyl]acetamide |
| SMILES | COc1ccc(OC)c(N(CC(=O)NCc2ccc(Cl)cc2)C(C)=O)c1 |
| InChI | InChI=1S/C19H21ClN2O4/c1-13(23)22(17-10-16(25-2)8-9-18(17)26-3)12-19(24)21-11-14-4-6-15(20)7-5-14/h4-10H,11-12H2,1-3H3,(H,21,24) |
| InChIKey | CKJXAUQMHLKHLK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |