C18H21N3O4 — CID 113174542
2-(N-acetyl-2,5-dimethoxyanilino)-N-(pyridin-2-ylmethyl)acetamide (PubChem CID 113174542) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is 2-(N-acetyl-2,5-dimethoxyanilino)-N-(pyridin-2-ylmethyl)acetamide.
| Compound Name | 2-(N-acetyl-2,5-dimethoxyanilino)-N-(pyridin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 113174542 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 2-(N-acetyl-2,5-dimethoxyanilino)-N-(pyridin-2-ylmethyl)acetamide |
| SMILES | COc1ccc(OC)c(N(CC(=O)NCc2ccccn2)C(C)=O)c1 |
| InChI | InChI=1S/C18H21N3O4/c1-13(22)21(16-10-15(24-2)7-8-17(16)25-3)12-18(23)20-11-14-6-4-5-9-19-14/h4-10H,11-12H2,1-3H3,(H,20,23) |
| InChIKey | BOZQBBWIPQOYLX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |