C21H26N2O4 — CID 113174903
2-(N-acetyl-3,4-dimethoxyanilino)-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 113174903) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-(N-acetyl-3,4-dimethoxyanilino)-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-(N-acetyl-3,4-dimethoxyanilino)-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 113174903 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 2-(N-acetyl-3,4-dimethoxyanilino)-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | COc1ccc(N(CC(=O)Nc2c(C)cc(C)cc2C)C(C)=O)cc1OC |
| InChI | InChI=1S/C21H26N2O4/c1-13-9-14(2)21(15(3)10-13)22-20(25)12-23(16(4)24)17-7-8-18(26-5)19(11-17)27-6/h7-11H,12H2,1-6H3,(H,22,25) |
| InChIKey | HWKYZGJWXTYUSM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |