C21H24N2O3 — CID 113175646
2-(N,4-diacetylanilino)-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 113175646) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 2-(N,4-diacetylanilino)-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-(N,4-diacetylanilino)-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 113175646 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 2-(N,4-diacetylanilino)-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | CC(=O)c1ccc(N(CC(=O)Nc2c(C)cc(C)cc2C)C(C)=O)cc1 |
| InChI | InChI=1S/C21H24N2O3/c1-13-10-14(2)21(15(3)11-13)22-20(26)12-23(17(5)25)19-8-6-18(7-9-19)16(4)24/h6-11H,12H2,1-5H3,(H,22,26) |
| InChIKey | AZEASRZKWGOQOJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |