C19H19F3N2O4 — CID 113175346
2-[N-acetyl-4-(trifluoromethyl)anilino]-N-(2,4-dimethoxyphenyl)acetamide (PubChem CID 113175346) has the molecular formula C19H19F3N2O4 and a molecular weight of 396.37 g/mol. Its IUPAC name is 2-[N-acetyl-4-(trifluoromethyl)anilino]-N-(2,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-[N-acetyl-4-(trifluoromethyl)anilino]-N-(2,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 113175346 |
| Molecular Formula | C19H19F3N2O4 |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 2-[N-acetyl-4-(trifluoromethyl)anilino]-N-(2,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CN(C(C)=O)c2ccc(C(F)(F)F)cc2)c(OC)c1 |
| InChI | InChI=1S/C19H19F3N2O4/c1-12(25)24(14-6-4-13(5-7-14)19(20,21)22)11-18(26)23-16-9-8-15(27-2)10-17(16)28-3/h4-10H,11H2,1-3H3,(H,23,26) |
| InChIKey | QSSYGJYAEPRYGK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |