C24H41NO7Si — CID 11317692
(3R,5S)-2-benzyl-3-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]-4,4-dimethoxyoxazinan-5-ol (PubChem CID 11317692) has the molecular formula C24H41NO7Si and a molecular weight of 483.68 g/mol. Its IUPAC name is (3R,5S)-2-benzyl-3-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]-4,4-dimethoxyoxazinan-5-ol.
| Compound Name | (3R,5S)-2-benzyl-3-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]-4,4-dimethoxyoxazinan-5-ol |
|---|---|
| PubChem CID | 11317692 |
| Molecular Formula | C24H41NO7Si |
| Molecular Weight | 483.68 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | (3R,5S)-2-benzyl-3-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]-4,4-dimethoxyoxazinan-5-ol |
| SMILES | COC1(OC)[C@@H](O)CON(Cc2ccccc2)[C@@H]1[C@@H]1O[C@H](C)OC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H41NO7Si/c1-17-29-15-19(32-33(7,8)23(2,3)4)21(31-17)22-24(27-5,28-6)20(26)16-30-25(22)14-18-12-10-9-11-13-18/h9-13,17,19-22,26H,14-16H2,1-8H3/t17-,19-,20+,21-,22-/m1/s1 |
| InChIKey | RCQAVMGAAOHPNH-MIUGBVLSSA-N |
| XLogP | 3.30 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.68 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|