C16H15Cl2N3O2 — CID 113179578
2-(N-acetyl-2,4-dichloroanilino)-N-(pyridin-4-ylmethyl)acetamide (PubChem CID 113179578) has the molecular formula C16H15Cl2N3O2 and a molecular weight of 352.22 g/mol. Its IUPAC name is 2-(N-acetyl-2,4-dichloroanilino)-N-(pyridin-4-ylmethyl)acetamide.
| Compound Name | 2-(N-acetyl-2,4-dichloroanilino)-N-(pyridin-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 113179578 |
| Molecular Formula | C16H15Cl2N3O2 |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 2-(N-acetyl-2,4-dichloroanilino)-N-(pyridin-4-ylmethyl)acetamide |
| SMILES | CC(=O)N(CC(=O)NCc1ccncc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H15Cl2N3O2/c1-11(22)21(15-3-2-13(17)8-14(15)18)10-16(23)20-9-12-4-6-19-7-5-12/h2-8H,9-10H2,1H3,(H,20,23) |
| InChIKey | GQRKIGLNPFDGSX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |