C18H20ClN3O3 — CID 113180325
2-(N-acetyl-4-chloro-2-methoxy-5-methylanilino)-N-(pyridin-4-ylmethyl)acetamide (PubChem CID 113180325) has the molecular formula C18H20ClN3O3 and a molecular weight of 361.83 g/mol. Its IUPAC name is 2-(N-acetyl-4-chloro-2-methoxy-5-methylanilino)-N-(pyridin-4-ylmethyl)acetamide.
| Compound Name | 2-(N-acetyl-4-chloro-2-methoxy-5-methylanilino)-N-(pyridin-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 113180325 |
| Molecular Formula | C18H20ClN3O3 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 2-(N-acetyl-4-chloro-2-methoxy-5-methylanilino)-N-(pyridin-4-ylmethyl)acetamide |
| SMILES | COc1cc(Cl)c(C)cc1N(CC(=O)NCc1ccncc1)C(C)=O |
| InChI | InChI=1S/C18H20ClN3O3/c1-12-8-16(17(25-3)9-15(12)19)22(13(2)23)11-18(24)21-10-14-4-6-20-7-5-14/h4-9H,10-11H2,1-3H3,(H,21,24) |
| InChIKey | PUKHHTSYCQESCE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |