C18H17Cl2FN2O3 — CID 113180373
2-(N-acetyl-4-chloro-2-methoxy-5-methylanilino)-N-(3-chloro-4-fluorophenyl)acetamide (PubChem CID 113180373) has the molecular formula C18H17Cl2FN2O3 and a molecular weight of 399.25 g/mol. Its IUPAC name is 2-(N-acetyl-4-chloro-2-methoxy-5-methylanilino)-N-(3-chloro-4-fluorophenyl)acetamide.
| Compound Name | 2-(N-acetyl-4-chloro-2-methoxy-5-methylanilino)-N-(3-chloro-4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 113180373 |
| Molecular Formula | C18H17Cl2FN2O3 |
| Molecular Weight | 399.25 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 2-(N-acetyl-4-chloro-2-methoxy-5-methylanilino)-N-(3-chloro-4-fluorophenyl)acetamide |
| SMILES | COc1cc(Cl)c(C)cc1N(CC(=O)Nc1ccc(F)c(Cl)c1)C(C)=O |
| InChI | InChI=1S/C18H17Cl2FN2O3/c1-10-6-16(17(26-3)8-13(10)19)23(11(2)24)9-18(25)22-12-4-5-15(21)14(20)7-12/h4-8H,9H2,1-3H3,(H,22,25) |
| InChIKey | LWDCUIIWFSXFJQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.25 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |