C15H19ClN2O4 — CID 113180210
2-(N-acetyl-4-chloro-2,5-dimethoxyanilino)-N-prop-2-enylacetamide (PubChem CID 113180210) has the molecular formula C15H19ClN2O4 and a molecular weight of 326.78 g/mol. Its IUPAC name is 2-(N-acetyl-4-chloro-2,5-dimethoxyanilino)-N-prop-2-enylacetamide.
| Compound Name | 2-(N-acetyl-4-chloro-2,5-dimethoxyanilino)-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 113180210 |
| Molecular Formula | C15H19ClN2O4 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 2-(N-acetyl-4-chloro-2,5-dimethoxyanilino)-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CN(C(C)=O)c1cc(OC)c(Cl)cc1OC |
| InChI | InChI=1S/C15H19ClN2O4/c1-5-6-17-15(20)9-18(10(2)19)12-8-13(21-3)11(16)7-14(12)22-4/h5,7-8H,1,6,9H2,2-4H3,(H,17,20) |
| InChIKey | GAJZSPXGMGYMGP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|