C25H45FO3SSi2 — CID 11318037
tert-butyl-[(2S,3S,4R,5S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-fluoro-2,4-dimethyl-5-phenylsulfanyloxan-3-yl]oxy-dimethylsilane (PubChem CID 11318037) has the molecular formula C25H45FO3SSi2 and a molecular weight of 500.87 g/mol. Its IUPAC name is tert-butyl-[(2S,3S,4R,5S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-fluoro-2,4-dimethyl-5-phenylsulfanyloxan-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S,3S,4R,5S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-fluoro-2,4-dimethyl-5-phenylsulfanyloxan-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11318037 |
| Molecular Formula | C25H45FO3SSi2 |
| Molecular Weight | 500.87 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | tert-butyl-[(2S,3S,4R,5S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-fluoro-2,4-dimethyl-5-phenylsulfanyloxan-3-yl]oxy-dimethylsilane |
| SMILES | C[C@@H]1O[C@@H](F)[C@@H](Sc2ccccc2)[C@](C)(O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H45FO3SSi2/c1-18-20(28-31(9,10)23(2,3)4)25(8,29-32(11,12)24(5,6)7)21(22(26)27-18)30-19-16-14-13-15-17-19/h13-18,20-22H,1-12H3/t18-,20-,21+,22+,25+/m0/s1 |
| InChIKey | NTLQRBIFGDITEX-PTICDVSASA-N |
| XLogP | 8.03 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.87 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|