C21H22N2O6 — CID 113180608
ethyl 2-[acetyl-[2-(3-methoxycarbonylanilino)-2-oxoethyl]amino]benzoate (PubChem CID 113180608) has the molecular formula C21H22N2O6 and a molecular weight of 398.42 g/mol. Its IUPAC name is ethyl 2-[acetyl-[2-(3-methoxycarbonylanilino)-2-oxoethyl]amino]benzoate.
| Compound Name | ethyl 2-[acetyl-[2-(3-methoxycarbonylanilino)-2-oxoethyl]amino]benzoate |
|---|---|
| PubChem CID | 113180608 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | ethyl 2-[acetyl-[2-(3-methoxycarbonylanilino)-2-oxoethyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1N(CC(=O)Nc1cccc(C(=O)OC)c1)C(C)=O |
| InChI | InChI=1S/C21H22N2O6/c1-4-29-21(27)17-10-5-6-11-18(17)23(14(2)24)13-19(25)22-16-9-7-8-15(12-16)20(26)28-3/h5-12H,4,13H2,1-3H3,(H,22,25) |
| InChIKey | UNNCEUFTTQYPKC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |