About 1-butan-2-yl-5-oxo-N,N-dipropylpyrrolidine-3-carboxamide
1-butan-2-yl-5-oxo-N,N-dipropylpyrrolidine-3-carboxamide (PubChem CID 113182159) has the molecular formula C15H28N2O2
and a molecular weight of 268.40 g/mol. Its IUPAC name is 1-butan-2-yl-5-oxo-N,N-dipropylpyrrolidine-3-carboxamide.
Molecular Properties
| Compound Name | 1-butan-2-yl-5-oxo-N,N-dipropylpyrrolidine-3-carboxamide |
| PubChem CID | 113182159 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 1-butan-2-yl-5-oxo-N,N-dipropylpyrrolidine-3-carboxamide |
| SMILES | CCCN(CCC)C(=O)C1CC(=O)N(C(C)CC)C1 |
| InChI | InChI=1S/C15H28N2O2/c1-5-8-16(9-6-2)15(19)13-10-14(18)17(11-13)12(4)7-3/h12-13H,5-11H2,1-4H3 |
| InChIKey | IRQJZSALFVUICG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-butan-2-yl-5-oxo-N,N-dipropylpyrrolidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butan-2-yl-5-oxo-N,N-dipropylpyrrolidine-3-carboxamide?
The IUPAC name of 1-butan-2-yl-5-oxo-N,N-dipropylpyrrolidine-3-carboxamide (CID 113182159) is 1-butan-2-yl-5-oxo-N,N-dipropylpyrrolidine-3-carboxamide.
What is the SMILES notation for 1-butan-2-yl-5-oxo-N,N-dipropylpyrrolidine-3-carboxamide?
The canonical SMILES for 1-butan-2-yl-5-oxo-N,N-dipropylpyrrolidine-3-carboxamide is CCCN(CCC)C(=O)C1CC(=O)N(C(C)CC)C1.
What is the InChIKey of 1-butan-2-yl-5-oxo-N,N-dipropylpyrrolidine-3-carboxamide?
The InChIKey is IRQJZSALFVUICG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2O2/c1-5-8-16(9-6-2)15(19)13-10-14(18)17(11-13)12(4)7-3/h12-13H,5-11H2,1-4H3.
What are the key properties of 1-butan-2-yl-5-oxo-N,N-dipropylpyrrolidine-3-carboxamide?
1-butan-2-yl-5-oxo-N,N-dipropylpyrrolidine-3-carboxamide has a molecular weight of 268.40 g/mol, XLogP of 2.28, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butan-2-yl-5-oxo-N,N-dipropylpyrrolidine-3-carboxamide is sourced from PubChem (CID 113182159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).