C15H28N2O2 — CID 113182159
1-butan-2-yl-5-oxo-N,N-dipropylpyrrolidine-3-carboxamide (PubChem CID 113182159) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 1-butan-2-yl-5-oxo-N,N-dipropylpyrrolidine-3-carboxamide.
| Compound Name | 1-butan-2-yl-5-oxo-N,N-dipropylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 113182159 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 1-butan-2-yl-5-oxo-N,N-dipropylpyrrolidine-3-carboxamide |
| SMILES | CCCN(CCC)C(=O)C1CC(=O)N(C(C)CC)C1 |
| InChI | InChI=1S/C15H28N2O2/c1-5-8-16(9-6-2)15(19)13-10-14(18)17(11-13)12(4)7-3/h12-13H,5-11H2,1-4H3 |
| InChIKey | IRQJZSALFVUICG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |