C20H19ClN2O4 — CID 113187822
methyl 3-[[1-(3-chloro-4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]benzoate (PubChem CID 113187822) has the molecular formula C20H19ClN2O4 and a molecular weight of 386.84 g/mol. Its IUPAC name is methyl 3-[[1-(3-chloro-4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]benzoate.
| Compound Name | methyl 3-[[1-(3-chloro-4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 113187822 |
| Molecular Formula | C20H19ClN2O4 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | methyl 3-[[1-(3-chloro-4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)C2CC(=O)N(c3ccc(C)c(Cl)c3)C2)c1 |
| InChI | InChI=1S/C20H19ClN2O4/c1-12-6-7-16(10-17(12)21)23-11-14(9-18(23)24)19(25)22-15-5-3-4-13(8-15)20(26)27-2/h3-8,10,14H,9,11H2,1-2H3,(H,22,25) |
| InChIKey | YIDXRHZRNBGFQQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |