C29H26N2O6 — CID 46569344
methyl 3-[2-[3-[[1-(3,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]phenyl]ethynyl]benzoate (PubChem CID 46569344) has the molecular formula C29H26N2O6 and a molecular weight of 498.54 g/mol. Its IUPAC name is methyl 3-[2-[3-[[1-(3,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]phenyl]ethynyl]benzoate.
| Compound Name | methyl 3-[2-[3-[[1-(3,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]phenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 46569344 |
| Molecular Formula | C29H26N2O6 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | methyl 3-[2-[3-[[1-(3,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]phenyl]ethynyl]benzoate |
| SMILES | COC(=O)c1cccc(C#Cc2cccc(NC(=O)C3CC(=O)N(c4ccc(OC)c(OC)c4)C3)c2)c1 |
| InChI | InChI=1S/C29H26N2O6/c1-35-25-13-12-24(17-26(25)36-2)31-18-22(16-27(31)32)28(33)30-23-9-5-7-20(15-23)11-10-19-6-4-8-21(14-19)29(34)37-3/h4-9,12-15,17,22H,16,18H2,1-3H3,(H,30,33) |
| InChIKey | NUQMVTNZNRUNIA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|