C24H27N3O2 — CID 113189841
4-(2-methyl-2,3-dihydroindole-1-carbonyl)-1-(4-pyrrolidin-1-ylphenyl)pyrrolidin-2-one (PubChem CID 113189841) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 4-(2-methyl-2,3-dihydroindole-1-carbonyl)-1-(4-pyrrolidin-1-ylphenyl)pyrrolidin-2-one.
| Compound Name | 4-(2-methyl-2,3-dihydroindole-1-carbonyl)-1-(4-pyrrolidin-1-ylphenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 113189841 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 4-(2-methyl-2,3-dihydroindole-1-carbonyl)-1-(4-pyrrolidin-1-ylphenyl)pyrrolidin-2-one |
| SMILES | CC1Cc2ccccc2N1C(=O)C1CC(=O)N(c2ccc(N3CCCC3)cc2)C1 |
| InChI | InChI=1S/C24H27N3O2/c1-17-14-18-6-2-3-7-22(18)27(17)24(29)19-15-23(28)26(16-19)21-10-8-20(9-11-21)25-12-4-5-13-25/h2-3,6-11,17,19H,4-5,12-16H2,1H3 |
| InChIKey | OXCGTWHGVXTVND-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|