C23H26FN3O2 — CID 113189868
N-[(2-fluorophenyl)methyl]-5-oxo-1-(4-piperidin-1-ylphenyl)pyrrolidine-3-carboxamide (PubChem CID 113189868) has the molecular formula C23H26FN3O2 and a molecular weight of 395.48 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-5-oxo-1-(4-piperidin-1-ylphenyl)pyrrolidine-3-carboxamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-5-oxo-1-(4-piperidin-1-ylphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 113189868 |
| Molecular Formula | C23H26FN3O2 |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-5-oxo-1-(4-piperidin-1-ylphenyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(NCc1ccccc1F)C1CC(=O)N(c2ccc(N3CCCCC3)cc2)C1 |
| InChI | InChI=1S/C23H26FN3O2/c24-21-7-3-2-6-17(21)15-25-23(29)18-14-22(28)27(16-18)20-10-8-19(9-11-20)26-12-4-1-5-13-26/h2-3,6-11,18H,1,4-5,12-16H2,(H,25,29) |
| InChIKey | OIXZYJRGOHSHQL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|