About bis(diethoxy-sulfanylidene-sulfido-λ5-phosphane);platinum(2+)
bis(diethoxy-sulfanylidene-sulfido-λ5-phosphane);platinum(2+) (PubChem CID 11319040) has the molecular formula C8H20O4P2PtS4
and a molecular weight of 565.54 g/mol. Its IUPAC name is bis(diethoxy-sulfanylidene-sulfido-λ5-phosphane);platinum(2+).
Molecular Properties
| Compound Name | bis(diethoxy-sulfanylidene-sulfido-λ5-phosphane);platinum(2+) |
| PubChem CID | 11319040 |
| Molecular Formula | C8H20O4P2PtS4 |
| Molecular Weight | 565.54 g/mol |
| Exact Mass | 564.94 |
| IUPAC Name | bis(diethoxy-sulfanylidene-sulfido-λ5-phosphane);platinum(2+) |
| SMILES | CCOP(=S)([S-])OCC.CCOP(=S)([S-])OCC.[Pt+2] |
| InChI | InChI=1S/2C4H11O2PS2.Pt/c2*1-3-5-7(8,9)6-4-2;/h2*3-4H2,1-2H3,(H,8,9);/q;;+2/p-2 |
| InChIKey | BENMFXGQPFPQBC-UHFFFAOYSA-L |
| XLogP | 3.66 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 565.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze bis(diethoxy-sulfanylidene-sulfido-λ5-phosphane);platinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(diethoxy-sulfanylidene-sulfido-λ5-phosphane);platinum(2+)?
The IUPAC name of bis(diethoxy-sulfanylidene-sulfido-λ5-phosphane);platinum(2+) (CID 11319040) is bis(diethoxy-sulfanylidene-sulfido-λ5-phosphane);platinum(2+).
What is the SMILES notation for bis(diethoxy-sulfanylidene-sulfido-λ5-phosphane);platinum(2+)?
The canonical SMILES for bis(diethoxy-sulfanylidene-sulfido-λ5-phosphane);platinum(2+) is CCOP(=S)([S-])OCC.CCOP(=S)([S-])OCC.[Pt+2].
What is the InChIKey of bis(diethoxy-sulfanylidene-sulfido-λ5-phosphane);platinum(2+)?
The InChIKey is BENMFXGQPFPQBC-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H11O2PS2.Pt/c2*1-3-5-7(8,9)6-4-2;/h2*3-4H2,1-2H3,(H,8,9);/q;;+2/p-2.
What are the key properties of bis(diethoxy-sulfanylidene-sulfido-λ5-phosphane);platinum(2+)?
bis(diethoxy-sulfanylidene-sulfido-λ5-phosphane);platinum(2+) has a molecular weight of 565.54 g/mol, XLogP of 3.66, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(diethoxy-sulfanylidene-sulfido-λ5-phosphane);platinum(2+) is sourced from PubChem (CID 11319040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).