C17H20ClF3N2O2 — CID 113190814
N-butyl-1-[4-chloro-3-(trifluoromethyl)phenyl]-N-methyl-5-oxopyrrolidine-3-carboxamide (PubChem CID 113190814) has the molecular formula C17H20ClF3N2O2 and a molecular weight of 376.81 g/mol. Its IUPAC name is N-butyl-1-[4-chloro-3-(trifluoromethyl)phenyl]-N-methyl-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-butyl-1-[4-chloro-3-(trifluoromethyl)phenyl]-N-methyl-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 113190814 |
| Molecular Formula | C17H20ClF3N2O2 |
| Molecular Weight | 376.81 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | N-butyl-1-[4-chloro-3-(trifluoromethyl)phenyl]-N-methyl-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCCCN(C)C(=O)C1CC(=O)N(c2ccc(Cl)c(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C17H20ClF3N2O2/c1-3-4-7-22(2)16(25)11-8-15(24)23(10-11)12-5-6-14(18)13(9-12)17(19,20)21/h5-6,9,11H,3-4,7-8,10H2,1-2H3 |
| InChIKey | RAXKSDLVQZEWCB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.81 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |