C18H10Cl2F6N2O2 — CID 126243563
1,4-bis[4-chloro-3-(trifluoromethyl)phenyl]piperazine-2,5-dione (PubChem CID 126243563) has the molecular formula C18H10Cl2F6N2O2 and a molecular weight of 471.18 g/mol. Its IUPAC name is 1,4-bis[4-chloro-3-(trifluoromethyl)phenyl]piperazine-2,5-dione.
| Compound Name | 1,4-bis[4-chloro-3-(trifluoromethyl)phenyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 126243563 |
| Molecular Formula | C18H10Cl2F6N2O2 |
| Molecular Weight | 471.18 g/mol |
| Exact Mass | 470.00 |
| IUPAC Name | 1,4-bis[4-chloro-3-(trifluoromethyl)phenyl]piperazine-2,5-dione |
| SMILES | O=C1CN(c2ccc(Cl)c(C(F)(F)F)c2)C(=O)CN1c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H10Cl2F6N2O2/c19-13-3-1-9(5-11(13)17(21,22)23)27-7-16(30)28(8-15(27)29)10-2-4-14(20)12(6-10)18(24,25)26/h1-6H,7-8H2 |
| InChIKey | UCTIOXJKFKHQTC-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.18 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |