C15H9ClF3NO2 — CID 154678653
3-[4-chloro-3-(trifluoromethyl)phenyl]-4H-1,3-benzoxazin-2-one (PubChem CID 154678653) has the molecular formula C15H9ClF3NO2 and a molecular weight of 327.69 g/mol. Its IUPAC name is 3-[4-chloro-3-(trifluoromethyl)phenyl]-4H-1,3-benzoxazin-2-one.
| Compound Name | 3-[4-chloro-3-(trifluoromethyl)phenyl]-4H-1,3-benzoxazin-2-one |
|---|---|
| PubChem CID | 154678653 |
| Molecular Formula | C15H9ClF3NO2 |
| Molecular Weight | 327.69 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 3-[4-chloro-3-(trifluoromethyl)phenyl]-4H-1,3-benzoxazin-2-one |
| SMILES | O=C1Oc2ccccc2CN1c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H9ClF3NO2/c16-12-6-5-10(7-11(12)15(17,18)19)20-8-9-3-1-2-4-13(9)22-14(20)21/h1-7H,8H2 |
| InChIKey | SDQWOZVQIIAIAN-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.69 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |