C15H12ClF3N2 — CID 43370032
2-[4-chloro-3-(trifluoromethyl)phenyl]-1,3-dihydroisoindol-4-amine (PubChem CID 43370032) has the molecular formula C15H12ClF3N2 and a molecular weight of 312.72 g/mol. Its IUPAC name is 2-[4-chloro-3-(trifluoromethyl)phenyl]-1,3-dihydroisoindol-4-amine.
| Compound Name | 2-[4-chloro-3-(trifluoromethyl)phenyl]-1,3-dihydroisoindol-4-amine |
|---|---|
| PubChem CID | 43370032 |
| Molecular Formula | C15H12ClF3N2 |
| Molecular Weight | 312.72 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 2-[4-chloro-3-(trifluoromethyl)phenyl]-1,3-dihydroisoindol-4-amine |
| SMILES | Nc1cccc2c1CN(c1ccc(Cl)c(C(F)(F)F)c1)C2 |
| InChI | InChI=1S/C15H12ClF3N2/c16-13-5-4-10(6-12(13)15(17,18)19)21-7-9-2-1-3-14(20)11(9)8-21/h1-6H,7-8,20H2 |
| InChIKey | JPBNVCGUHJTUOC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.72 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|