C14H16Cl2N2O2 — CID 113190926
1-(2,4-dichlorophenyl)-5-oxo-N-propylpyrrolidine-3-carboxamide (PubChem CID 113190926) has the molecular formula C14H16Cl2N2O2 and a molecular weight of 315.20 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-5-oxo-N-propylpyrrolidine-3-carboxamide.
| Compound Name | 1-(2,4-dichlorophenyl)-5-oxo-N-propylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 113190926 |
| Molecular Formula | C14H16Cl2N2O2 |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-5-oxo-N-propylpyrrolidine-3-carboxamide |
| SMILES | CCCNC(=O)C1CC(=O)N(c2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C14H16Cl2N2O2/c1-2-5-17-14(20)9-6-13(19)18(8-9)12-4-3-10(15)7-11(12)16/h3-4,7,9H,2,5-6,8H2,1H3,(H,17,20) |
| InChIKey | KAPBWRBCPVVRLI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |