C19H19Cl2N3O2 — CID 113191199
1-(3,5-dichlorophenyl)-N-[4-(dimethylamino)phenyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 113191199) has the molecular formula C19H19Cl2N3O2 and a molecular weight of 392.29 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-N-[4-(dimethylamino)phenyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(3,5-dichlorophenyl)-N-[4-(dimethylamino)phenyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 113191199 |
| Molecular Formula | C19H19Cl2N3O2 |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-N-[4-(dimethylamino)phenyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)C2CC(=O)N(c3cc(Cl)cc(Cl)c3)C2)cc1 |
| InChI | InChI=1S/C19H19Cl2N3O2/c1-23(2)16-5-3-15(4-6-16)22-19(26)12-7-18(25)24(11-12)17-9-13(20)8-14(21)10-17/h3-6,8-10,12H,7,11H2,1-2H3,(H,22,26) |
| InChIKey | VEZPYVHVBAZQFU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|