C21H21F3N2O2 — CID 113192156
N-(2,6-diethylphenyl)-5-oxo-1-(2,3,4-trifluorophenyl)pyrrolidine-3-carboxamide (PubChem CID 113192156) has the molecular formula C21H21F3N2O2 and a molecular weight of 390.41 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-5-oxo-1-(2,3,4-trifluorophenyl)pyrrolidine-3-carboxamide.
| Compound Name | N-(2,6-diethylphenyl)-5-oxo-1-(2,3,4-trifluorophenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 113192156 |
| Molecular Formula | C21H21F3N2O2 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | N-(2,6-diethylphenyl)-5-oxo-1-(2,3,4-trifluorophenyl)pyrrolidine-3-carboxamide |
| SMILES | CCc1cccc(CC)c1NC(=O)C1CC(=O)N(c2ccc(F)c(F)c2F)C1 |
| InChI | InChI=1S/C21H21F3N2O2/c1-3-12-6-5-7-13(4-2)20(12)25-21(28)14-10-17(27)26(11-14)16-9-8-15(22)18(23)19(16)24/h5-9,14H,3-4,10-11H2,1-2H3,(H,25,28) |
| InChIKey | ZRKQZOARFMQSGC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|