C17H11ClF4N2O2 — CID 113192169
N-(3-chloro-4-fluorophenyl)-5-oxo-1-(2,3,4-trifluorophenyl)pyrrolidine-3-carboxamide (PubChem CID 113192169) has the molecular formula C17H11ClF4N2O2 and a molecular weight of 386.73 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-5-oxo-1-(2,3,4-trifluorophenyl)pyrrolidine-3-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-5-oxo-1-(2,3,4-trifluorophenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 113192169 |
| Molecular Formula | C17H11ClF4N2O2 |
| Molecular Weight | 386.73 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-5-oxo-1-(2,3,4-trifluorophenyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)C1CC(=O)N(c2ccc(F)c(F)c2F)C1 |
| InChI | InChI=1S/C17H11ClF4N2O2/c18-10-6-9(1-2-11(10)19)23-17(26)8-5-14(25)24(7-8)13-4-3-12(20)15(21)16(13)22/h1-4,6,8H,5,7H2,(H,23,26) |
| InChIKey | ZZXXHQBCJDOZCK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.73 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|