C18H16Cl2FN3O2 — CID 55628688
N-(4-amino-3,5-dichlorophenyl)-1-(2-fluoro-4-methylphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 55628688) has the molecular formula C18H16Cl2FN3O2 and a molecular weight of 396.25 g/mol. Its IUPAC name is N-(4-amino-3,5-dichlorophenyl)-1-(2-fluoro-4-methylphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-(4-amino-3,5-dichlorophenyl)-1-(2-fluoro-4-methylphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55628688 |
| Molecular Formula | C18H16Cl2FN3O2 |
| Molecular Weight | 396.25 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | N-(4-amino-3,5-dichlorophenyl)-1-(2-fluoro-4-methylphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(N2CC(C(=O)Nc3cc(Cl)c(N)c(Cl)c3)CC2=O)c(F)c1 |
| InChI | InChI=1S/C18H16Cl2FN3O2/c1-9-2-3-15(14(21)4-9)24-8-10(5-16(24)25)18(26)23-11-6-12(19)17(22)13(20)7-11/h2-4,6-7,10H,5,8,22H2,1H3,(H,23,26) |
| InChIKey | WFEOXYJTMRCNHU-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.25 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|