C15H19N5O2 — CID 113192862
4-[[6-[2-(dimethylamino)ethylamino]pyrimidin-4-yl]amino]benzoic acid (PubChem CID 113192862) has the molecular formula C15H19N5O2 and a molecular weight of 301.35 g/mol. Its IUPAC name is 4-[[6-[2-(dimethylamino)ethylamino]pyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 4-[[6-[2-(dimethylamino)ethylamino]pyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 113192862 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 4-[[6-[2-(dimethylamino)ethylamino]pyrimidin-4-yl]amino]benzoic acid |
| SMILES | CN(C)CCNc1cc(Nc2ccc(C(=O)O)cc2)ncn1 |
| InChI | InChI=1S/C15H19N5O2/c1-20(2)8-7-16-13-9-14(18-10-17-13)19-12-5-3-11(4-6-12)15(21)22/h3-6,9-10H,7-8H2,1-2H3,(H,21,22)(H2,16,17,18,19) |
| InChIKey | USRAJAXUSYZHAG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |