C19H18N4O2 — CID 113192938
4-[[6-(3,5-dimethylanilino)pyrimidin-4-yl]amino]benzoic acid (PubChem CID 113192938) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is 4-[[6-(3,5-dimethylanilino)pyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 4-[[6-(3,5-dimethylanilino)pyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 113192938 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 4-[[6-(3,5-dimethylanilino)pyrimidin-4-yl]amino]benzoic acid |
| SMILES | Cc1cc(C)cc(Nc2cc(Nc3ccc(C(=O)O)cc3)ncn2)c1 |
| InChI | InChI=1S/C19H18N4O2/c1-12-7-13(2)9-16(8-12)23-18-10-17(20-11-21-18)22-15-5-3-14(4-6-15)19(24)25/h3-11H,1-2H3,(H,24,25)(H2,20,21,22,23) |
| InChIKey | IMBJUFDNBCKMTN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |