C36H41N3O7 — CID 11319594
(3aS,4S,7aR)-4-[(2S,3R,4S,5S,6R)-4-azido-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole (PubChem CID 11319594) has the molecular formula C36H41N3O7 and a molecular weight of 627.74 g/mol. Its IUPAC name is (3aS,4S,7aR)-4-[(2S,3R,4S,5S,6R)-4-azido-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole.
| Compound Name | (3aS,4S,7aR)-4-[(2S,3R,4S,5S,6R)-4-azido-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole |
|---|---|
| PubChem CID | 11319594 |
| Molecular Formula | C36H41N3O7 |
| Molecular Weight | 627.74 g/mol |
| Exact Mass | 627.29 |
| IUPAC Name | (3aS,4S,7aR)-4-[(2S,3R,4S,5S,6R)-4-azido-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole |
| SMILES | CC1(C)O[C@H]2[C@@H](O[C@H]3O[C@H](COCc4ccccc4)[C@@H](OCc4ccccc4)[C@H](N=[N+]=[N-])[C@H]3OCc3ccccc3)CC=C[C@H]2O1 |
| InChI | InChI=1S/C36H41N3O7/c1-36(2)45-29-20-12-19-28(32(29)46-36)43-35-34(42-23-27-17-10-5-11-18-27)31(38-39-37)33(41-22-26-15-8-4-9-16-26)30(44-35)24-40-21-25-13-6-3-7-14-25/h3-18,20,28-35H,19,21-24H2,1-2H3/t28-,29+,30+,31-,32-,33+,34+,35-/m0/s1 |
| InChIKey | FJJXKQQZOXTKSS-PRFQOCRPSA-N |
| XLogP | 6.64 |
| TPSA | 113.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.74 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|