C16H18ClN3O3 — CID 113201284
4-chloro-2-[2-(4-ethylpiperazin-1-yl)-2-oxoethyl]isoindole-1,3-dione (PubChem CID 113201284) has the molecular formula C16H18ClN3O3 and a molecular weight of 335.79 g/mol. Its IUPAC name is 4-chloro-2-[2-(4-ethylpiperazin-1-yl)-2-oxoethyl]isoindole-1,3-dione.
| Compound Name | 4-chloro-2-[2-(4-ethylpiperazin-1-yl)-2-oxoethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 113201284 |
| Molecular Formula | C16H18ClN3O3 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 4-chloro-2-[2-(4-ethylpiperazin-1-yl)-2-oxoethyl]isoindole-1,3-dione |
| SMILES | CCN1CCN(C(=O)CN2C(=O)c3cccc(Cl)c3C2=O)CC1 |
| InChI | InChI=1S/C16H18ClN3O3/c1-2-18-6-8-19(9-7-18)13(21)10-20-15(22)11-4-3-5-12(17)14(11)16(20)23/h3-5H,2,6-10H2,1H3 |
| InChIKey | JFVZAJPOFBFTBY-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|