C19H18N2O2 — CID 113205056
N-(3-acetylphenyl)-3,6-dimethyl-1H-indole-2-carboxamide (PubChem CID 113205056) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is N-(3-acetylphenyl)-3,6-dimethyl-1H-indole-2-carboxamide.
| Compound Name | N-(3-acetylphenyl)-3,6-dimethyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 113205056 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | N-(3-acetylphenyl)-3,6-dimethyl-1H-indole-2-carboxamide |
| SMILES | CC(=O)c1cccc(NC(=O)c2[nH]c3cc(C)ccc3c2C)c1 |
| InChI | InChI=1S/C19H18N2O2/c1-11-7-8-16-12(2)18(21-17(16)9-11)19(23)20-15-6-4-5-14(10-15)13(3)22/h4-10,21H,1-3H3,(H,20,23) |
| InChIKey | VNDKFQISFHPKFY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|