C17H14ClFN2O — CID 113205279
6-chloro-N-[(2-fluorophenyl)methyl]-3-methyl-1H-indole-2-carboxamide (PubChem CID 113205279) has the molecular formula C17H14ClFN2O and a molecular weight of 316.76 g/mol. Its IUPAC name is 6-chloro-N-[(2-fluorophenyl)methyl]-3-methyl-1H-indole-2-carboxamide.
| Compound Name | 6-chloro-N-[(2-fluorophenyl)methyl]-3-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 113205279 |
| Molecular Formula | C17H14ClFN2O |
| Molecular Weight | 316.76 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 6-chloro-N-[(2-fluorophenyl)methyl]-3-methyl-1H-indole-2-carboxamide |
| SMILES | Cc1c(C(=O)NCc2ccccc2F)[nH]c2cc(Cl)ccc12 |
| InChI | InChI=1S/C17H14ClFN2O/c1-10-13-7-6-12(18)8-15(13)21-16(10)17(22)20-9-11-4-2-3-5-14(11)19/h2-8,21H,9H2,1H3,(H,20,22) |
| InChIKey | DFEMWEGSXOKUJB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.76 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|