C23H24FN3O2 — CID 113210609
[1-(5-fluoro-1H-indol-3-yl)cyclopropyl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 113210609) has the molecular formula C23H24FN3O2 and a molecular weight of 393.46 g/mol. Its IUPAC name is [1-(5-fluoro-1H-indol-3-yl)cyclopropyl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [1-(5-fluoro-1H-indol-3-yl)cyclopropyl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 113210609 |
| Molecular Formula | C23H24FN3O2 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | [1-(5-fluoro-1H-indol-3-yl)cyclopropyl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccccc1N1CCN(C(=O)C2(c3c[nH]c4ccc(F)cc34)CC2)CC1 |
| InChI | InChI=1S/C23H24FN3O2/c1-29-21-5-3-2-4-20(21)26-10-12-27(13-11-26)22(28)23(8-9-23)18-15-25-19-7-6-16(24)14-17(18)19/h2-7,14-15,25H,8-13H2,1H3 |
| InChIKey | WAFQLVKLTDEHQA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |