C23H24FN3O — CID 113210608
[1-(5-fluoro-1H-indol-3-yl)cyclopropyl]-[4-(3-methylphenyl)piperazin-1-yl]methanone (PubChem CID 113210608) has the molecular formula C23H24FN3O and a molecular weight of 377.46 g/mol. Its IUPAC name is [1-(5-fluoro-1H-indol-3-yl)cyclopropyl]-[4-(3-methylphenyl)piperazin-1-yl]methanone.
| Compound Name | [1-(5-fluoro-1H-indol-3-yl)cyclopropyl]-[4-(3-methylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 113210608 |
| Molecular Formula | C23H24FN3O |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | [1-(5-fluoro-1H-indol-3-yl)cyclopropyl]-[4-(3-methylphenyl)piperazin-1-yl]methanone |
| SMILES | Cc1cccc(N2CCN(C(=O)C3(c4c[nH]c5ccc(F)cc45)CC3)CC2)c1 |
| InChI | InChI=1S/C23H24FN3O/c1-16-3-2-4-18(13-16)26-9-11-27(12-10-26)22(28)23(7-8-23)20-15-25-21-6-5-17(24)14-19(20)21/h2-6,13-15,25H,7-12H2,1H3 |
| InChIKey | OEUSUXOTWZBMIW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |