C13H13NO2 — CID 82278306
1-(5-methyl-1H-indol-3-yl)cyclopropane-1-carboxylic acid (PubChem CID 82278306) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is 1-(5-methyl-1H-indol-3-yl)cyclopropane-1-carboxylic acid.
| Compound Name | 1-(5-methyl-1H-indol-3-yl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 82278306 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 1-(5-methyl-1H-indol-3-yl)cyclopropane-1-carboxylic acid |
| SMILES | Cc1ccc2[nH]cc(C3(C(=O)O)CC3)c2c1 |
| InChI | InChI=1S/C13H13NO2/c1-8-2-3-11-9(6-8)10(7-14-11)13(4-5-13)12(15)16/h2-3,6-7,14H,4-5H2,1H3,(H,15,16) |
| InChIKey | SOFVUARFIHTCPV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |