C8H15NO2 — CID 11321097
(4S,5S,8aS)-4-methyl-5-oxido-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-5-ium (PubChem CID 11321097) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is (4S,5S,8aS)-4-methyl-5-oxido-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-5-ium.
| Compound Name | (4S,5S,8aS)-4-methyl-5-oxido-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-5-ium |
|---|---|
| PubChem CID | 11321097 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | (4S,5S,8aS)-4-methyl-5-oxido-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-5-ium |
| SMILES | C[C@H]1COC[C@@H]2CCC[N@@+]21[O-] |
| InChI | InChI=1S/C8H15NO2/c1-7-5-11-6-8-3-2-4-9(7,8)10/h7-8H,2-6H2,1H3/t7-,8-,9-/m0/s1 |
| InChIKey | HNNFMEZDLMFXCL-CIUDSAMLSA-N |
| XLogP | 0.88 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|