C21H21FN2O — CID 113211109
1-(6-fluoro-1H-indol-3-yl)-N-(3-phenylpropyl)cyclopropane-1-carboxamide (PubChem CID 113211109) has the molecular formula C21H21FN2O and a molecular weight of 336.41 g/mol. Its IUPAC name is 1-(6-fluoro-1H-indol-3-yl)-N-(3-phenylpropyl)cyclopropane-1-carboxamide.
| Compound Name | 1-(6-fluoro-1H-indol-3-yl)-N-(3-phenylpropyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 113211109 |
| Molecular Formula | C21H21FN2O |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 1-(6-fluoro-1H-indol-3-yl)-N-(3-phenylpropyl)cyclopropane-1-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)C1(c2c[nH]c3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C21H21FN2O/c22-16-8-9-17-18(14-24-19(17)13-16)21(10-11-21)20(25)23-12-4-7-15-5-2-1-3-6-15/h1-3,5-6,8-9,13-14,24H,4,7,10-12H2,(H,23,25) |
| InChIKey | RJXFPQDBPVYVEG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|