C18H14F2N2O — CID 113211144
1-(6-fluoro-1H-indol-3-yl)-N-(4-fluorophenyl)cyclopropane-1-carboxamide (PubChem CID 113211144) has the molecular formula C18H14F2N2O and a molecular weight of 312.32 g/mol. Its IUPAC name is 1-(6-fluoro-1H-indol-3-yl)-N-(4-fluorophenyl)cyclopropane-1-carboxamide.
| Compound Name | 1-(6-fluoro-1H-indol-3-yl)-N-(4-fluorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 113211144 |
| Molecular Formula | C18H14F2N2O |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 1-(6-fluoro-1H-indol-3-yl)-N-(4-fluorophenyl)cyclopropane-1-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)C1(c2c[nH]c3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C18H14F2N2O/c19-11-1-4-13(5-2-11)22-17(23)18(7-8-18)15-10-21-16-9-12(20)3-6-14(15)16/h1-6,9-10,21H,7-8H2,(H,22,23) |
| InChIKey | AXYIEQAJTUTDTR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |