C21H24N2O4 — CID 113211295
N-(4-ethylphenyl)-2-(4,5,6-trimethoxy-1H-indol-3-yl)acetamide (PubChem CID 113211295) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is N-(4-ethylphenyl)-2-(4,5,6-trimethoxy-1H-indol-3-yl)acetamide.
| Compound Name | N-(4-ethylphenyl)-2-(4,5,6-trimethoxy-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 113211295 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | N-(4-ethylphenyl)-2-(4,5,6-trimethoxy-1H-indol-3-yl)acetamide |
| SMILES | CCc1ccc(NC(=O)Cc2c[nH]c3cc(OC)c(OC)c(OC)c23)cc1 |
| InChI | InChI=1S/C21H24N2O4/c1-5-13-6-8-15(9-7-13)23-18(24)10-14-12-22-16-11-17(25-2)20(26-3)21(27-4)19(14)16/h6-9,11-12,22H,5,10H2,1-4H3,(H,23,24) |
| InChIKey | RNRXXJKJFHSCDP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |