C17H24N2O4 — CID 113211220
N-butyl-2-(4,5,6-trimethoxy-1H-indol-3-yl)acetamide (PubChem CID 113211220) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is N-butyl-2-(4,5,6-trimethoxy-1H-indol-3-yl)acetamide.
| Compound Name | N-butyl-2-(4,5,6-trimethoxy-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 113211220 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | N-butyl-2-(4,5,6-trimethoxy-1H-indol-3-yl)acetamide |
| SMILES | CCCCNC(=O)Cc1c[nH]c2cc(OC)c(OC)c(OC)c12 |
| InChI | InChI=1S/C17H24N2O4/c1-5-6-7-18-14(20)8-11-10-19-12-9-13(21-2)16(22-3)17(23-4)15(11)12/h9-10,19H,5-8H2,1-4H3,(H,18,20) |
| InChIKey | XPEHNCKJCNGJJS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|