C20H28N2O4 — CID 113084605
N-[2-(4,5,6-trimethoxy-1H-indol-3-yl)ethyl]cyclohexanecarboxamide (PubChem CID 113084605) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is N-[2-(4,5,6-trimethoxy-1H-indol-3-yl)ethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-(4,5,6-trimethoxy-1H-indol-3-yl)ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 113084605 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | N-[2-(4,5,6-trimethoxy-1H-indol-3-yl)ethyl]cyclohexanecarboxamide |
| SMILES | COc1cc2[nH]cc(CCNC(=O)C3CCCCC3)c2c(OC)c1OC |
| InChI | InChI=1S/C20H28N2O4/c1-24-16-11-15-17(19(26-3)18(16)25-2)14(12-22-15)9-10-21-20(23)13-7-5-4-6-8-13/h11-13,22H,4-10H2,1-3H3,(H,21,23) |
| InChIKey | VDQTVZCSLAYQCR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |