C22H25N3O — CID 113211474
2-(1,2-dimethylindol-3-yl)-N-(4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 113211474) has the molecular formula C22H25N3O and a molecular weight of 347.46 g/mol. Its IUPAC name is 2-(1,2-dimethylindol-3-yl)-N-(4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-(1,2-dimethylindol-3-yl)-N-(4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 113211474 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 2-(1,2-dimethylindol-3-yl)-N-(4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | Cc1c(CC(=O)Nc2ccc(N3CCCC3)cc2)c2ccccc2n1C |
| InChI | InChI=1S/C22H25N3O/c1-16-20(19-7-3-4-8-21(19)24(16)2)15-22(26)23-17-9-11-18(12-10-17)25-13-5-6-14-25/h3-4,7-12H,5-6,13-15H2,1-2H3,(H,23,26) |
| InChIKey | GVUQOMUSRKYWMI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|